C27H29N3O4S — CID 19197319
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19197319) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19197319 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)CCCCCN3C(=O)c4ccccc4C3=O)n2)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-2-3-17-34-20-14-12-19(13-15-20)23-18-35-27(28-23)29-24(31)11-5-4-8-16-30-25(32)21-9-6-7-10-22(21)26(30)33/h6-7,9-10,12-15,18H,2-5,8,11,16-17H2,1H3,(H,28,29,31) |
| InChIKey | VFJRDPAKEMDEFH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|