C19H18FNO2S — CID 9367760
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide (PubChem CID 9367760) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 9367760 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide |
| SMILES | C[C@@H](NC(=O)CCSc1ccc(F)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H18FNO2S/c1-13(18-12-14-4-2-3-5-17(14)23-18)21-19(22)10-11-24-16-8-6-15(20)7-9-16/h2-9,12-13H,10-11H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | VPUOZGZSQPUJHD-CYBMUJFWSA-N |
| XLogP | 4.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |