C15H16FNOS2 — CID 47098774
3-(4-fluorophenyl)sulfanyl-N-(1-thiophen-2-ylethyl)propanamide (PubChem CID 47098774) has the molecular formula C15H16FNOS2 and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N-(1-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N-(1-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 47098774 |
| Molecular Formula | C15H16FNOS2 |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N-(1-thiophen-2-ylethyl)propanamide |
| SMILES | CC(NC(=O)CCSc1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H16FNOS2/c1-11(14-3-2-9-20-14)17-15(18)8-10-19-13-6-4-12(16)5-7-13/h2-7,9,11H,8,10H2,1H3,(H,17,18) |
| InChIKey | NAKZUFZXPQPPGT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |