C11H16ClNOS — CID 81408351
5-chloro-N-[(1R)-1-thiophen-2-ylethyl]pentanamide (PubChem CID 81408351) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-thiophen-2-ylethyl]pentanamide.
| Compound Name | 5-chloro-N-[(1R)-1-thiophen-2-ylethyl]pentanamide |
|---|---|
| PubChem CID | 81408351 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-chloro-N-[(1R)-1-thiophen-2-ylethyl]pentanamide |
| SMILES | C[C@@H](NC(=O)CCCCCl)c1cccs1 |
| InChI | InChI=1S/C11H16ClNOS/c1-9(10-5-4-8-15-10)13-11(14)6-2-3-7-12/h4-5,8-9H,2-3,6-7H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | LZADUUDMDQHENY-SECBINFHSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|