C18H23NO3S — CID 112766186
4-(2-ethoxyphenoxy)-N-(1-thiophen-2-ylethyl)butanamide (PubChem CID 112766186) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-(1-thiophen-2-ylethyl)butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-(1-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 112766186 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-(1-thiophen-2-ylethyl)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NC(C)c1cccs1 |
| InChI | InChI=1S/C18H23NO3S/c1-3-21-15-8-4-5-9-16(15)22-12-6-11-18(20)19-14(2)17-10-7-13-23-17/h4-5,7-10,13-14H,3,6,11-12H2,1-2H3,(H,19,20) |
| InChIKey | IUYUMSHHVZUTLN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|