C14H14ClNOS2 — CID 7501191
2-(4-chlorophenyl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide (PubChem CID 7501191) has the molecular formula C14H14ClNOS2 and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 7501191 |
| Molecular Formula | C14H14ClNOS2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CSc1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C14H14ClNOS2/c1-10(13-3-2-8-18-13)16-14(17)9-19-12-6-4-11(15)5-7-12/h2-8,10H,9H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | JIDVEPSUZSXCLP-SNVBAGLBSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |