C17H19ClN2O2S — CID 39964074
(3S)-3-acetamido-3-(4-chlorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide (PubChem CID 39964074) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is (3S)-3-acetamido-3-(4-chlorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide.
| Compound Name | (3S)-3-acetamido-3-(4-chlorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide |
|---|---|
| PubChem CID | 39964074 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (3S)-3-acetamido-3-(4-chlorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide |
| SMILES | CC(=O)N[C@@H](CC(=O)N[C@H](C)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O2S/c1-11(16-4-3-9-23-16)19-17(22)10-15(20-12(2)21)13-5-7-14(18)8-6-13/h3-9,11,15H,10H2,1-2H3,(H,19,22)(H,20,21)/t11-,15+/m1/s1 |
| InChIKey | AKEBVBNSAKZYLR-ABAIWWIYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |