C17H18ClNO3S2 — CID 55514197
methyl 3-[3-(4-chlorophenyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate (PubChem CID 55514197) has the molecular formula C17H18ClNO3S2 and a molecular weight of 383.92 g/mol. Its IUPAC name is methyl 3-[3-(4-chlorophenyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[3-(4-chlorophenyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 55514197 |
| Molecular Formula | C17H18ClNO3S2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | methyl 3-[3-(4-chlorophenyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)CCSc1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C17H18ClNO3S2/c1-22-17(21)11-14(15-3-2-9-24-15)19-16(20)8-10-23-13-6-4-12(18)5-7-13/h2-7,9,14H,8,10-11H2,1H3,(H,19,20) |
| InChIKey | WZLLTHUEJWJAAF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |