C18H17Cl2NO3S — CID 55440619
methyl 3-(2-chlorophenyl)-3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]propanoate (PubChem CID 55440619) has the molecular formula C18H17Cl2NO3S and a molecular weight of 398.31 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]propanoate |
|---|---|
| PubChem CID | 55440619 |
| Molecular Formula | C18H17Cl2NO3S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CSc1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H17Cl2NO3S/c1-24-18(23)10-16(14-4-2-3-5-15(14)20)21-17(22)11-25-13-8-6-12(19)7-9-13/h2-9,16H,10-11H2,1H3,(H,21,22) |
| InChIKey | KWHPKYMPQSSJFY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |