C13H14ClN5O3 — CID 94016801
methyl (3S)-3-(2-chlorophenyl)-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoate (PubChem CID 94016801) has the molecular formula C13H14ClN5O3 and a molecular weight of 323.74 g/mol. Its IUPAC name is methyl (3S)-3-(2-chlorophenyl)-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl (3S)-3-(2-chlorophenyl)-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 94016801 |
| Molecular Formula | C13H14ClN5O3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | methyl (3S)-3-(2-chlorophenyl)-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)Cn1cnnn1)c1ccccc1Cl |
| InChI | InChI=1S/C13H14ClN5O3/c1-22-13(21)6-11(9-4-2-3-5-10(9)14)16-12(20)7-19-8-15-17-18-19/h2-5,8,11H,6-7H2,1H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | HWSMVEIFZMQPGJ-NSHDSACASA-N |
| XLogP | 0.75 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |