C20H19Cl2N5O3 — CID 5295418
ethyl 3-(2-chlorophenyl)-3-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]propanoate (PubChem CID 5295418) has the molecular formula C20H19Cl2N5O3 and a molecular weight of 448.31 g/mol. Its IUPAC name is ethyl 3-(2-chlorophenyl)-3-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(2-chlorophenyl)-3-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 5295418 |
| Molecular Formula | C20H19Cl2N5O3 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | ethyl 3-(2-chlorophenyl)-3-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)Cn1nnc(-c2ccc(Cl)cc2)n1)c1ccccc1Cl |
| InChI | InChI=1S/C20H19Cl2N5O3/c1-2-30-19(29)11-17(15-5-3-4-6-16(15)22)23-18(28)12-27-25-20(24-26-27)13-7-9-14(21)10-8-13/h3-10,17H,2,11-12H2,1H3,(H,23,28) |
| InChIKey | INMPWGKWBPTAAE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |