C21H22ClN5O3 — CID 4976813
ethyl 3-(2-chlorophenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate (PubChem CID 4976813) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is ethyl 3-(2-chlorophenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(2-chlorophenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 4976813 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | ethyl 3-(2-chlorophenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)Cn1nnc(-c2ccccc2C)n1)c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClN5O3/c1-3-30-20(29)12-18(16-10-6-7-11-17(16)22)23-19(28)13-27-25-21(24-26-27)15-9-5-4-8-14(15)2/h4-11,18H,3,12-13H2,1-2H3,(H,23,28) |
| InChIKey | XRMJGJSNJOJCNK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |