C22H25N5O4 — CID 5296511
ethyl 3-(4-methoxyphenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate (PubChem CID 5296511) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 3-(4-methoxyphenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(4-methoxyphenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 5296511 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | ethyl 3-(4-methoxyphenyl)-3-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)Cn1nnc(-c2ccccc2C)n1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25N5O4/c1-4-31-21(29)13-19(16-9-11-17(30-3)12-10-16)23-20(28)14-27-25-22(24-26-27)18-8-6-5-7-15(18)2/h5-12,19H,4,13-14H2,1-3H3,(H,23,28) |
| InChIKey | QKNHMIWVSUPZTB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |