C17H24ClNO4 — CID 51114947
methyl 3-(2-chlorophenyl)-3-[2-(2-methylpropoxy)propanoylamino]propanoate (PubChem CID 51114947) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[2-(2-methylpropoxy)propanoylamino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[2-(2-methylpropoxy)propanoylamino]propanoate |
|---|---|
| PubChem CID | 51114947 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[2-(2-methylpropoxy)propanoylamino]propanoate |
| SMILES | COC(=O)CC(NC(=O)C(C)OCC(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C17H24ClNO4/c1-11(2)10-23-12(3)17(21)19-15(9-16(20)22-4)13-7-5-6-8-14(13)18/h5-8,11-12,15H,9-10H2,1-4H3,(H,19,21) |
| InChIKey | AGLDBFMJPFCYJU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |