C20H19ClN2O4 — CID 51256873
methyl 3-(2-chlorophenyl)-3-[2-(4-cyanophenoxy)propanoylamino]propanoate (PubChem CID 51256873) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[2-(4-cyanophenoxy)propanoylamino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[2-(4-cyanophenoxy)propanoylamino]propanoate |
|---|---|
| PubChem CID | 51256873 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[2-(4-cyanophenoxy)propanoylamino]propanoate |
| SMILES | COC(=O)CC(NC(=O)C(C)Oc1ccc(C#N)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C20H19ClN2O4/c1-13(27-15-9-7-14(12-22)8-10-15)20(25)23-18(11-19(24)26-2)16-5-3-4-6-17(16)21/h3-10,13,18H,11H2,1-2H3,(H,23,25) |
| InChIKey | UONAZWXXUPHMSA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |