C18H16Cl2N2O2 — CID 55793168
N-[1-(4-cyanophenyl)ethyl]-2-(3,4-dichlorophenoxy)propanamide (PubChem CID 55793168) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)ethyl]-2-(3,4-dichlorophenoxy)propanamide.
| Compound Name | N-[1-(4-cyanophenyl)ethyl]-2-(3,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 55793168 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[1-(4-cyanophenyl)ethyl]-2-(3,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1)C(=O)NC(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-11(14-5-3-13(10-21)4-6-14)22-18(23)12(2)24-15-7-8-16(19)17(20)9-15/h3-9,11-12H,1-2H3,(H,22,23) |
| InChIKey | BXZBHVQMTZXODN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |