C17H13Cl2N3O2 — CID 5433222
(2R)-2-(4-cyanophenoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]propanamide (PubChem CID 5433222) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is (2R)-2-(4-cyanophenoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-cyanophenoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5433222 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | (2R)-2-(4-cyanophenoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)N/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c1-11(24-14-5-2-12(9-20)3-6-14)17(23)22-21-10-13-4-7-15(18)16(19)8-13/h2-8,10-11H,1H3,(H,22,23)/b21-10-/t11-/m1/s1 |
| InChIKey | QRKLTBIOUJIKMZ-VARIZKOUSA-N |
| XLogP | 3.78 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|