C20H19N3O2 — CID 3670228
2-(4-cyanophenoxy)-N-[(2-methyl-3-phenylprop-2-enylidene)amino]propanamide (PubChem CID 3670228) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(2-methyl-3-phenylprop-2-enylidene)amino]propanamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(2-methyl-3-phenylprop-2-enylidene)amino]propanamide |
|---|---|
| PubChem CID | 3670228 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(2-methyl-3-phenylprop-2-enylidene)amino]propanamide |
| SMILES | CC(C=NNC(=O)C(C)Oc1ccc(C#N)cc1)=Cc1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c1-15(12-17-6-4-3-5-7-17)14-22-23-20(24)16(2)25-19-10-8-18(13-21)9-11-19/h3-12,14,16H,1-2H3,(H,23,24) |
| InChIKey | CFVAODYKGOXNOC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|