C12H15Cl2NO2 — CID 47109802
2-(3,4-dichlorophenoxy)-N-propan-2-ylpropanamide (PubChem CID 47109802) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-propan-2-ylpropanamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 47109802 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO2/c1-7(2)15-12(16)8(3)17-9-4-5-10(13)11(14)6-9/h4-8H,1-3H3,(H,15,16) |
| InChIKey | HJKVUWYEXOFHDX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |