C14H17Cl2NO2 — CID 2706554
(2R)-N-cyclopentyl-2-(3,4-dichlorophenoxy)propanamide (PubChem CID 2706554) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-(3,4-dichlorophenoxy)propanamide.
| Compound Name | (2R)-N-cyclopentyl-2-(3,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 2706554 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (2R)-N-cyclopentyl-2-(3,4-dichlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-9(14(18)17-10-4-2-3-5-10)19-11-6-7-12(15)13(16)8-11/h6-10H,2-5H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | LQHTZAPAPHEERP-SECBINFHSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |