C13H15Cl2NO3 — CID 9487944
[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 3,4-dichlorobenzoate (PubChem CID 9487944) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 3,4-dichlorobenzoate.
| Compound Name | [(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 9487944 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | [(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl] 3,4-dichlorobenzoate |
| SMILES | CC(C)NC(=O)[C@H](C)OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-7(2)16-12(17)8(3)19-13(18)9-4-5-10(14)11(15)6-9/h4-8H,1-3H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | WWHBDFOFYFXPDO-QMMMGPOBSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |