C13H15Cl2NO4 — CID 8569640
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,4-dichlorobenzoate (PubChem CID 8569640) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,4-dichlorobenzoate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 8569640 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,4-dichlorobenzoate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO4/c1-8(12(17)16-5-6-19-2)20-13(18)9-3-4-10(14)11(15)7-9/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | IWTMMUJYFDGXIK-QMMMGPOBSA-N |
| XLogP | 2.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|