C13H16Cl2N2O4 — CID 61322559
[1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-amino-4,5-dichlorobenzoate (PubChem CID 61322559) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-amino-4,5-dichlorobenzoate.
| Compound Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-amino-4,5-dichlorobenzoate |
|---|---|
| PubChem CID | 61322559 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-amino-4,5-dichlorobenzoate |
| SMILES | COCCNC(=O)C(C)OC(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-7(12(18)17-3-4-20-2)21-13(19)8-5-9(14)11(15)10(16)6-8/h5-7H,3-4,16H2,1-2H3,(H,17,18) |
| InChIKey | RQVHRDKPARYHJL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|