C14H20N2O4 — CID 61322293
[1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-amino-2-methylbenzoate (PubChem CID 61322293) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-amino-2-methylbenzoate.
| Compound Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 61322293 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-amino-2-methylbenzoate |
| SMILES | COCCNC(=O)C(C)OC(=O)c1cc(N)ccc1C |
| InChI | InChI=1S/C14H20N2O4/c1-9-4-5-11(15)8-12(9)14(18)20-10(2)13(17)16-6-7-19-3/h4-5,8,10H,6-7,15H2,1-3H3,(H,16,17) |
| InChIKey | ODHFPWQITHOHGX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|