C13H19N3O4 — CID 61322933
[1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,5-diaminobenzoate (PubChem CID 61322933) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,5-diaminobenzoate.
| Compound Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 61322933 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3,5-diaminobenzoate |
| SMILES | COCCNC(=O)C(C)OC(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C13H19N3O4/c1-8(12(17)16-3-4-19-2)20-13(18)9-5-10(14)7-11(15)6-9/h5-8H,3-4,14-15H2,1-2H3,(H,16,17) |
| InChIKey | FLJZXUZNBGIQJP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|