C9H17NO5 — CID 87160018
[1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-methoxyacetate (PubChem CID 87160018) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-methoxyacetate.
| Compound Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 87160018 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-methoxyacetate |
| SMILES | COCCNC(=O)C(C)OC(=O)COC |
| InChI | InChI=1S/C9H17NO5/c1-7(15-8(11)6-14-3)9(12)10-4-5-13-2/h7H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | RHHMSZXOSYEOTR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|