C17H25NO4S — CID 8879255
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(3,4-dimethylphenyl)sulfanylpropanoate (PubChem CID 8879255) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(3,4-dimethylphenyl)sulfanylpropanoate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(3,4-dimethylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8879255 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-(3,4-dimethylphenyl)sulfanylpropanoate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)CCSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H25NO4S/c1-12-5-6-15(11-13(12)2)23-10-7-16(19)22-14(3)17(20)18-8-9-21-4/h5-6,11,14H,7-10H2,1-4H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | FMEZYUMLEKJUEZ-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|