C16H24O3S — CID 78830378
2-propan-2-yloxyethyl 3-(3,4-dimethylphenyl)sulfanylpropanoate (PubChem CID 78830378) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 3-(3,4-dimethylphenyl)sulfanylpropanoate.
| Compound Name | 2-propan-2-yloxyethyl 3-(3,4-dimethylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 78830378 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-propan-2-yloxyethyl 3-(3,4-dimethylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)OCCOC(C)C)cc1C |
| InChI | InChI=1S/C16H24O3S/c1-12(2)18-8-9-19-16(17)7-10-20-15-6-5-13(3)14(4)11-15/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | IYKGLIHVVNVMFC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|