C16H24O3 — CID 78832911
2-propan-2-yloxyethyl 3-(2,4-dimethylphenyl)propanoate (PubChem CID 78832911) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 3-(2,4-dimethylphenyl)propanoate.
| Compound Name | 2-propan-2-yloxyethyl 3-(2,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 78832911 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-propan-2-yloxyethyl 3-(2,4-dimethylphenyl)propanoate |
| SMILES | Cc1ccc(CCC(=O)OCCOC(C)C)c(C)c1 |
| InChI | InChI=1S/C16H24O3/c1-12(2)18-9-10-19-16(17)8-7-15-6-5-13(3)11-14(15)4/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | LNYUIBLROYHHSY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|