C11H15NO2 — CID 123427544
2-(2,4-dimethylphenyl)ethyl carbamate (PubChem CID 123427544) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)ethyl carbamate.
| Compound Name | 2-(2,4-dimethylphenyl)ethyl carbamate |
|---|---|
| PubChem CID | 123427544 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)ethyl carbamate |
| SMILES | Cc1ccc(CCOC(N)=O)c(C)c1 |
| InChI | InChI=1S/C11H15NO2/c1-8-3-4-10(9(2)7-8)5-6-14-11(12)13/h3-4,7H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | UCBVYCQSIVGAAQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |