C15H24O2S — CID 142858731
1,2-dimethyl-4-[2-(2-propan-2-yloxyethoxy)ethylsulfanyl]benzene (PubChem CID 142858731) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 1,2-dimethyl-4-[2-(2-propan-2-yloxyethoxy)ethylsulfanyl]benzene.
| Compound Name | 1,2-dimethyl-4-[2-(2-propan-2-yloxyethoxy)ethylsulfanyl]benzene |
|---|---|
| PubChem CID | 142858731 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1,2-dimethyl-4-[2-(2-propan-2-yloxyethoxy)ethylsulfanyl]benzene |
| SMILES | Cc1ccc(SCCOCCOC(C)C)cc1C |
| InChI | InChI=1S/C15H24O2S/c1-12(2)17-8-7-16-9-10-18-15-6-5-13(3)14(4)11-15/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | PPOQVPFINRIRIG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|