C16H18S2 — CID 79326651
1,2-dimethyl-4-(2-phenylsulfanylethylsulfanyl)benzene (PubChem CID 79326651) has the molecular formula C16H18S2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1,2-dimethyl-4-(2-phenylsulfanylethylsulfanyl)benzene.
| Compound Name | 1,2-dimethyl-4-(2-phenylsulfanylethylsulfanyl)benzene |
|---|---|
| PubChem CID | 79326651 |
| Molecular Formula | C16H18S2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1,2-dimethyl-4-(2-phenylsulfanylethylsulfanyl)benzene |
| SMILES | Cc1ccc(SCCSc2ccccc2)cc1C |
| InChI | InChI=1S/C16H18S2/c1-13-8-9-16(12-14(13)2)18-11-10-17-15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | ANMZJERVTVVVIZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|