C11H16S — CID 130694880
1,2-dimethyl-4-propylsulfanylbenzene (PubChem CID 130694880) has the molecular formula C11H16S and a molecular weight of 180.32 g/mol. Its IUPAC name is 1,2-dimethyl-4-propylsulfanylbenzene.
| Compound Name | 1,2-dimethyl-4-propylsulfanylbenzene |
|---|---|
| PubChem CID | 130694880 |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1,2-dimethyl-4-propylsulfanylbenzene |
| SMILES | CCCSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H16S/c1-4-7-12-11-6-5-9(2)10(3)8-11/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | WWGFFJCOJSCISA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |