C16H32O3S2 — CID 144520473
1,2-dimethyl-4-propylsulfanylbenzene;ethane;methanesulfonic acid (PubChem CID 144520473) has the molecular formula C16H32O3S2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 1,2-dimethyl-4-propylsulfanylbenzene;ethane;methanesulfonic acid.
| Compound Name | 1,2-dimethyl-4-propylsulfanylbenzene;ethane;methanesulfonic acid |
|---|---|
| PubChem CID | 144520473 |
| Molecular Formula | C16H32O3S2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1,2-dimethyl-4-propylsulfanylbenzene;ethane;methanesulfonic acid |
| SMILES | CC.CC.CCCSc1ccc(C)c(C)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C11H16S.2C2H6.CH4O3S/c1-4-7-12-11-6-5-9(2)10(3)8-11;2*1-2;1-5(2,3)4/h5-6,8H,4,7H2,1-3H3;2*1-2H3;1H3,(H,2,3,4) |
| InChIKey | UUIIXXLYWWVWTM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|