C16H25NS — CID 55092477
N-[3-(3,4-dimethylphenyl)sulfanylpropyl]cyclopentanamine (PubChem CID 55092477) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is N-[3-(3,4-dimethylphenyl)sulfanylpropyl]cyclopentanamine.
| Compound Name | N-[3-(3,4-dimethylphenyl)sulfanylpropyl]cyclopentanamine |
|---|---|
| PubChem CID | 55092477 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[3-(3,4-dimethylphenyl)sulfanylpropyl]cyclopentanamine |
| SMILES | Cc1ccc(SCCCNC2CCCC2)cc1C |
| InChI | InChI=1S/C16H25NS/c1-13-8-9-16(12-14(13)2)18-11-5-10-17-15-6-3-4-7-15/h8-9,12,15,17H,3-7,10-11H2,1-2H3 |
| InChIKey | JICFTZLOTKAOLB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|