C18H29NOS — CID 64805569
2-(cyclopropylamino)-6-(3,4-dimethylphenyl)sulfanyl-2-methylhexan-1-ol (PubChem CID 64805569) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is 2-(cyclopropylamino)-6-(3,4-dimethylphenyl)sulfanyl-2-methylhexan-1-ol.
| Compound Name | 2-(cyclopropylamino)-6-(3,4-dimethylphenyl)sulfanyl-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 64805569 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-(cyclopropylamino)-6-(3,4-dimethylphenyl)sulfanyl-2-methylhexan-1-ol |
| SMILES | Cc1ccc(SCCCCC(C)(CO)NC2CC2)cc1C |
| InChI | InChI=1S/C18H29NOS/c1-14-6-9-17(12-15(14)2)21-11-5-4-10-18(3,13-20)19-16-7-8-16/h6,9,12,16,19-20H,4-5,7-8,10-11,13H2,1-3H3 |
| InChIKey | NGZPXPFFJJPYNI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|