C16H23NS — CID 106712588
6-(3,4-dimethylphenyl)sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106712588) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-(3,4-dimethylphenyl)sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712588 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 6-(3,4-dimethylphenyl)sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | Cc1ccc(SCCCCC(C)(C)C#N)cc1C |
| InChI | InChI=1S/C16H23NS/c1-13-7-8-15(11-14(13)2)18-10-6-5-9-16(3,4)12-17/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | XZVLNCNXZUWUSA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|