C18H28N2S — CID 106714604
6-[4-[1-(ethylamino)ethyl]phenyl]sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106714604) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 6-[4-[1-(ethylamino)ethyl]phenyl]sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-[4-[1-(ethylamino)ethyl]phenyl]sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106714604 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 6-[4-[1-(ethylamino)ethyl]phenyl]sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | CCNC(C)c1ccc(SCCCCC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C18H28N2S/c1-5-20-15(2)16-8-10-17(11-9-16)21-13-7-6-12-18(3,4)14-19/h8-11,15,20H,5-7,12-13H2,1-4H3 |
| InChIKey | GTMFIVFSZXVCSJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|