C15H21NOS — CID 106712580
6-(4-methoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106712580) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-methoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712580 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-(4-methoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | COc1ccc(SCCCCC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C15H21NOS/c1-15(2,12-16)10-4-5-11-18-14-8-6-13(17-3)7-9-14/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | WWHSCXKMMQMZJB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|