C13H17NOS — CID 65176494
4-(3-methoxyphenyl)sulfanyl-2,2-dimethylbutanenitrile (PubChem CID 65176494) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)sulfanyl-2,2-dimethylbutanenitrile.
| Compound Name | 4-(3-methoxyphenyl)sulfanyl-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65176494 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(3-methoxyphenyl)sulfanyl-2,2-dimethylbutanenitrile |
| SMILES | COc1cccc(SCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C13H17NOS/c1-13(2,10-14)7-8-16-12-6-4-5-11(9-12)15-3/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | GUZJXRULQFKEDP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |