C12H13F2NS — CID 65176383
4-(3,4-difluorophenyl)sulfanyl-2,2-dimethylbutanenitrile (PubChem CID 65176383) has the molecular formula C12H13F2NS and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-2,2-dimethylbutanenitrile.
| Compound Name | 4-(3,4-difluorophenyl)sulfanyl-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65176383 |
| Molecular Formula | C12H13F2NS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanyl-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NS/c1-12(2,8-15)5-6-16-9-3-4-10(13)11(14)7-9/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | BCARHIACMCPVIO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |