C13H17ClN2S — CID 79149942
5-(4-amino-3-chlorophenyl)sulfanyl-2,2-dimethylpentanenitrile (PubChem CID 79149942) has the molecular formula C13H17ClN2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 5-(4-amino-3-chlorophenyl)sulfanyl-2,2-dimethylpentanenitrile.
| Compound Name | 5-(4-amino-3-chlorophenyl)sulfanyl-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 79149942 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-(4-amino-3-chlorophenyl)sulfanyl-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCSc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2S/c1-13(2,9-15)6-3-7-17-10-4-5-12(16)11(14)8-10/h4-5,8H,3,6-7,16H2,1-2H3 |
| InChIKey | ISVYLRSDDUZEKO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|