C14H17Cl2NS — CID 106712573
6-(2,5-dichlorophenyl)sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106712573) has the molecular formula C14H17Cl2NS and a molecular weight of 302.27 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2,5-dichlorophenyl)sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712573 |
| Molecular Formula | C14H17Cl2NS |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 6-(2,5-dichlorophenyl)sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17Cl2NS/c1-14(2,10-17)7-3-4-8-18-13-9-11(15)5-6-12(13)16/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | LXPFEXVTCXQLMF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|