C14H19ClN2S — CID 106712533
6-(4-amino-2-chlorophenyl)sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106712533) has the molecular formula C14H19ClN2S and a molecular weight of 282.84 g/mol. Its IUPAC name is 6-(4-amino-2-chlorophenyl)sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-amino-2-chlorophenyl)sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712533 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 6-(4-amino-2-chlorophenyl)sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCSc1ccc(N)cc1Cl |
| InChI | InChI=1S/C14H19ClN2S/c1-14(2,10-16)7-3-4-8-18-13-6-5-11(17)9-12(13)15/h5-6,9H,3-4,7-8,17H2,1-2H3 |
| InChIKey | GZZAETFUCUQNED-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|