C16H24N2OS — CID 106712558
6-(2-amino-5-ethoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106712558) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 6-(2-amino-5-ethoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2-amino-5-ethoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712558 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 6-(2-amino-5-ethoxyphenyl)sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | CCOc1ccc(N)c(SCCCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C16H24N2OS/c1-4-19-13-7-8-14(18)15(11-13)20-10-6-5-9-16(2,3)12-17/h7-8,11H,4-6,9-10,18H2,1-3H3 |
| InChIKey | SAHHWHVYZOMMCF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|