C11H14F3NO2S — CID 106705107
4-ethoxy-2-(2,2,2-trifluoroethoxymethylsulfanyl)aniline (PubChem CID 106705107) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-ethoxy-2-(2,2,2-trifluoroethoxymethylsulfanyl)aniline.
| Compound Name | 4-ethoxy-2-(2,2,2-trifluoroethoxymethylsulfanyl)aniline |
|---|---|
| PubChem CID | 106705107 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-ethoxy-2-(2,2,2-trifluoroethoxymethylsulfanyl)aniline |
| SMILES | CCOc1ccc(N)c(SCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-2-17-8-3-4-9(15)10(5-8)18-7-16-6-11(12,13)14/h3-5H,2,6-7,15H2,1H3 |
| InChIKey | HAGSNCDHZXZWSW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|