C10H11F4NOS — CID 79148523
4-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]aniline (PubChem CID 79148523) has the molecular formula C10H11F4NOS and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]aniline.
| Compound Name | 4-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]aniline |
|---|---|
| PubChem CID | 79148523 |
| Molecular Formula | C10H11F4NOS |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]aniline |
| SMILES | Nc1ccc(F)cc1SCCOCC(F)(F)F |
| InChI | InChI=1S/C10H11F4NOS/c11-7-1-2-8(15)9(5-7)17-4-3-16-6-10(12,13)14/h1-2,5H,3-4,6,15H2 |
| InChIKey | FZLVDQJDLKKRLT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|