C11H13F4NO3S — CID 81183092
4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline (PubChem CID 81183092) has the molecular formula C11H13F4NO3S and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline.
| Compound Name | 4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline |
|---|---|
| PubChem CID | 81183092 |
| Molecular Formula | C11H13F4NO3S |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-fluoro-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline |
| SMILES | Nc1ccc(F)cc1S(=O)(=O)CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H13F4NO3S/c12-8-2-3-9(16)10(6-8)20(17,18)5-1-4-19-7-11(13,14)15/h2-3,6H,1,4-5,7,16H2 |
| InChIKey | YDRARNYXMVSREI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|