C12H16F3NO4S — CID 81200862
3-methoxy-4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline (PubChem CID 81200862) has the molecular formula C12H16F3NO4S and a molecular weight of 327.32 g/mol. Its IUPAC name is 3-methoxy-4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline.
| Compound Name | 3-methoxy-4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline |
|---|---|
| PubChem CID | 81200862 |
| Molecular Formula | C12H16F3NO4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-methoxy-4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline |
| SMILES | COc1cc(N)ccc1S(=O)(=O)CCCOCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO4S/c1-19-10-7-9(16)3-4-11(10)21(17,18)6-2-5-20-8-12(13,14)15/h3-4,7H,2,5-6,8,16H2,1H3 |
| InChIKey | ZSNFBECLQZGDJP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|