C12H16F3NO3S — CID 81191592
5-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline (PubChem CID 81191592) has the molecular formula C12H16F3NO3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 5-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline.
| Compound Name | 5-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline |
|---|---|
| PubChem CID | 81191592 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-methyl-2-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]aniline |
| SMILES | Cc1ccc(S(=O)(=O)CCCOCC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C12H16F3NO3S/c1-9-3-4-11(10(16)7-9)20(17,18)6-2-5-19-8-12(13,14)15/h3-4,7H,2,5-6,8,16H2,1H3 |
| InChIKey | GAAYLFQZBWKCTO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|